C13H17ClN2O5 — CID 79271305
5-chloro-2-methoxy-4-[[2-(2-methoxyethylamino)acetyl]amino]benzoic acid (PubChem CID 79271305) has the molecular formula C13H17ClN2O5 and a molecular weight of 316.74 g/mol. Its IUPAC name is 5-chloro-2-methoxy-4-[[2-(2-methoxyethylamino)acetyl]amino]benzoic acid.
| Compound Name | 5-chloro-2-methoxy-4-[[2-(2-methoxyethylamino)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 79271305 |
| Molecular Formula | C13H17ClN2O5 |
| Molecular Weight | 316.74 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 5-chloro-2-methoxy-4-[[2-(2-methoxyethylamino)acetyl]amino]benzoic acid |
| SMILES | COCCNCC(=O)Nc1cc(OC)c(C(=O)O)cc1Cl |
| InChI | InChI=1S/C13H17ClN2O5/c1-20-4-3-15-7-12(17)16-10-6-11(21-2)8(13(18)19)5-9(10)14/h5-6,15H,3-4,7H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | FYMBXFHMVKZUOL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.74 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|