C19H30ClN3O5 — CID 119711915
N-[4,5-dimethoxy-2-(piperidine-1-carbonyl)phenyl]-2-(2-methoxyethylamino)acetamide;hydrochloride (PubChem CID 119711915) has the molecular formula C19H30ClN3O5 and a molecular weight of 415.92 g/mol. Its IUPAC name is N-[4,5-dimethoxy-2-(piperidine-1-carbonyl)phenyl]-2-(2-methoxyethylamino)acetamide;hydrochloride.
| Compound Name | N-[4,5-dimethoxy-2-(piperidine-1-carbonyl)phenyl]-2-(2-methoxyethylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119711915 |
| Molecular Formula | C19H30ClN3O5 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-[4,5-dimethoxy-2-(piperidine-1-carbonyl)phenyl]-2-(2-methoxyethylamino)acetamide;hydrochloride |
| SMILES | COCCNCC(=O)Nc1cc(OC)c(OC)cc1C(=O)N1CCCCC1.Cl |
| InChI | InChI=1S/C19H29N3O5.ClH/c1-25-10-7-20-13-18(23)21-15-12-17(27-3)16(26-2)11-14(15)19(24)22-8-5-4-6-9-22;/h11-12,20H,4-10,13H2,1-3H3,(H,21,23);1H |
| InChIKey | FLJJUVGJPVJRLO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|