C22H27N3O4 — CID 120620884
5-amino-N-[4,5-dimethoxy-2-(piperidine-1-carbonyl)phenyl]-2-methylbenzamide (PubChem CID 120620884) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is 5-amino-N-[4,5-dimethoxy-2-(piperidine-1-carbonyl)phenyl]-2-methylbenzamide.
| Compound Name | 5-amino-N-[4,5-dimethoxy-2-(piperidine-1-carbonyl)phenyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 120620884 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 5-amino-N-[4,5-dimethoxy-2-(piperidine-1-carbonyl)phenyl]-2-methylbenzamide |
| SMILES | COc1cc(NC(=O)c2cc(N)ccc2C)c(C(=O)N2CCCCC2)cc1OC |
| InChI | InChI=1S/C22H27N3O4/c1-14-7-8-15(23)11-16(14)21(26)24-18-13-20(29-3)19(28-2)12-17(18)22(27)25-9-5-4-6-10-25/h7-8,11-13H,4-6,9-10,23H2,1-3H3,(H,24,26) |
| InChIKey | KZXWQDJOCIUEGP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|