C16H18N2O4 — CID 119811908
methyl 2-[4-[[2-(methylamino)acetyl]amino]naphthalen-1-yl]oxyacetate (PubChem CID 119811908) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is methyl 2-[4-[[2-(methylamino)acetyl]amino]naphthalen-1-yl]oxyacetate.
| Compound Name | methyl 2-[4-[[2-(methylamino)acetyl]amino]naphthalen-1-yl]oxyacetate |
|---|---|
| PubChem CID | 119811908 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | methyl 2-[4-[[2-(methylamino)acetyl]amino]naphthalen-1-yl]oxyacetate |
| SMILES | CNCC(=O)Nc1ccc(OCC(=O)OC)c2ccccc12 |
| InChI | InChI=1S/C16H18N2O4/c1-17-9-15(19)18-13-7-8-14(22-10-16(20)21-2)12-6-4-3-5-11(12)13/h3-8,17H,9-10H2,1-2H3,(H,18,19) |
| InChIKey | RZICPLPRTONBHH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |