C17H19O3S+ — CID 58520264
methyl 2-[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]oxyacetate (PubChem CID 58520264) has the molecular formula C17H19O3S+ and a molecular weight of 303.40 g/mol. Its IUPAC name is methyl 2-[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]oxyacetate.
| Compound Name | methyl 2-[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]oxyacetate |
|---|---|
| PubChem CID | 58520264 |
| Molecular Formula | C17H19O3S+ |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | methyl 2-[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]oxyacetate |
| SMILES | COC(=O)COc1ccc([S+]2CCCC2)c2ccccc12 |
| InChI | InChI=1S/C17H19O3S/c1-19-17(18)12-20-15-8-9-16(21-10-4-5-11-21)14-7-3-2-6-13(14)15/h2-3,6-9H,4-5,10-12H2,1H3/q+1 |
| InChIKey | RTVJBYVEIZGBAR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|