C17H21O2S2+ — CID 140816164
1-[4-(2-methoxyethoxy)naphthalen-1-yl]-1,4-dithian-1-ium (PubChem CID 140816164) has the molecular formula C17H21O2S2+ and a molecular weight of 321.49 g/mol. Its IUPAC name is 1-[4-(2-methoxyethoxy)naphthalen-1-yl]-1,4-dithian-1-ium.
| Compound Name | 1-[4-(2-methoxyethoxy)naphthalen-1-yl]-1,4-dithian-1-ium |
|---|---|
| PubChem CID | 140816164 |
| Molecular Formula | C17H21O2S2+ |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 1-[4-(2-methoxyethoxy)naphthalen-1-yl]-1,4-dithian-1-ium |
| SMILES | COCCOc1ccc([S+]2CCSCC2)c2ccccc12 |
| InChI | InChI=1S/C17H21O2S2/c1-18-8-9-19-16-6-7-17(21-12-10-20-11-13-21)15-5-3-2-4-14(15)16/h2-7H,8-13H2,1H3/q+1 |
| InChIKey | YMEKLBMVDJMLIZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|