C17H19O2S+ — CID 140816173
[4-(thiolan-1-ium-1-yl)naphthalen-1-yl] propanoate (PubChem CID 140816173) has the molecular formula C17H19O2S+ and a molecular weight of 287.40 g/mol. Its IUPAC name is [4-(thiolan-1-ium-1-yl)naphthalen-1-yl] propanoate.
| Compound Name | [4-(thiolan-1-ium-1-yl)naphthalen-1-yl] propanoate |
|---|---|
| PubChem CID | 140816173 |
| Molecular Formula | C17H19O2S+ |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | [4-(thiolan-1-ium-1-yl)naphthalen-1-yl] propanoate |
| SMILES | CCC(=O)Oc1ccc([S+]2CCCC2)c2ccccc12 |
| InChI | InChI=1S/C17H19O2S/c1-2-17(18)19-15-9-10-16(20-11-5-6-12-20)14-8-4-3-7-13(14)15/h3-4,7-10H,2,5-6,11-12H2,1H3/q+1 |
| InChIKey | PGGRSYVBGDWIFN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|