C28H25O3S+ — CID 169051469
(3-methyl-1-phenylpenta-1,4-diyn-3-yl) 2-[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]oxyacetate (PubChem CID 169051469) has the molecular formula C28H25O3S+ and a molecular weight of 441.57 g/mol. Its IUPAC name is (3-methyl-1-phenylpenta-1,4-diyn-3-yl) 2-[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]oxyacetate.
| Compound Name | (3-methyl-1-phenylpenta-1,4-diyn-3-yl) 2-[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]oxyacetate |
|---|---|
| PubChem CID | 169051469 |
| Molecular Formula | C28H25O3S+ |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | (3-methyl-1-phenylpenta-1,4-diyn-3-yl) 2-[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]oxyacetate |
| SMILES | C#CC(C)(C#Cc1ccccc1)OC(=O)COc1ccc([S+]2CCCC2)c2ccccc12 |
| InChI | InChI=1S/C28H25O3S/c1-3-28(2,18-17-22-11-5-4-6-12-22)31-27(29)21-30-25-15-16-26(32-19-9-10-20-32)24-14-8-7-13-23(24)25/h1,4-8,11-16H,9-10,19-21H2,2H3/q+1 |
| InChIKey | YXDPQFWJIWJPDX-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|