C19H25OS+ — CID 140816243
1-[4-[(2-methylpropan-2-yl)oxy]naphthalen-1-yl]thian-1-ium (PubChem CID 140816243) has the molecular formula C19H25OS+ and a molecular weight of 301.48 g/mol. Its IUPAC name is 1-[4-[(2-methylpropan-2-yl)oxy]naphthalen-1-yl]thian-1-ium.
| Compound Name | 1-[4-[(2-methylpropan-2-yl)oxy]naphthalen-1-yl]thian-1-ium |
|---|---|
| PubChem CID | 140816243 |
| Molecular Formula | C19H25OS+ |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 1-[4-[(2-methylpropan-2-yl)oxy]naphthalen-1-yl]thian-1-ium |
| SMILES | CC(C)(C)Oc1ccc([S+]2CCCCC2)c2ccccc12 |
| InChI | InChI=1S/C19H25OS/c1-19(2,3)20-17-11-12-18(21-13-7-4-8-14-21)16-10-6-5-9-15(16)17/h5-6,9-12H,4,7-8,13-14H2,1-3H3/q+1 |
| InChIKey | JEWGRVQBMIGFOG-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|