C16H19S+ — CID 59080190
1-(4-methylnaphthalen-1-yl)thian-1-ium (PubChem CID 59080190) has the molecular formula C16H19S+ and a molecular weight of 243.40 g/mol. Its IUPAC name is 1-(4-methylnaphthalen-1-yl)thian-1-ium.
| Compound Name | 1-(4-methylnaphthalen-1-yl)thian-1-ium |
|---|---|
| PubChem CID | 59080190 |
| Molecular Formula | C16H19S+ |
| Molecular Weight | 243.40 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 1-(4-methylnaphthalen-1-yl)thian-1-ium |
| SMILES | Cc1ccc([S+]2CCCCC2)c2ccccc12 |
| InChI | InChI=1S/C16H19S/c1-13-9-10-16(17-11-5-2-6-12-17)15-8-4-3-7-14(13)15/h3-4,7-10H,2,5-6,11-12H2,1H3/q+1 |
| InChIKey | GSDFBOJSJNIZSH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|