C29H30 — CID 160811650
9,10-dimethylanthracene;1,4-dimethylnaphthalene;methane (PubChem CID 160811650) has the molecular formula C29H30 and a molecular weight of 378.56 g/mol. Its IUPAC name is 9,10-dimethylanthracene;1,4-dimethylnaphthalene;methane.
| Compound Name | 9,10-dimethylanthracene;1,4-dimethylnaphthalene;methane |
|---|---|
| PubChem CID | 160811650 |
| Molecular Formula | C29H30 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 9,10-dimethylanthracene;1,4-dimethylnaphthalene;methane |
| SMILES | C.Cc1c2ccccc2c(C)c2ccccc12.Cc1ccc(C)c2ccccc12 |
| InChI | InChI=1S/C16H14.C12H12.CH4/c1-11-13-7-3-5-9-15(13)12(2)16-10-6-4-8-14(11)16;1-9-7-8-10(2)12-6-4-3-5-11(9)12;/h3-10H,1-2H3;3-8H,1-2H3;1H4 |
| InChIKey | SEJIWHQETVXTRK-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|