C19H32 — CID 142394206
ethane;1,2,5-trimethylnaphthalene (PubChem CID 142394206) has the molecular formula C19H32 and a molecular weight of 260.46 g/mol. Its IUPAC name is ethane;1,2,5-trimethylnaphthalene.
| Compound Name | ethane;1,2,5-trimethylnaphthalene |
|---|---|
| PubChem CID | 142394206 |
| Molecular Formula | C19H32 |
| Molecular Weight | 260.46 g/mol |
| Exact Mass | 260.25 |
| IUPAC Name | ethane;1,2,5-trimethylnaphthalene |
| SMILES | CC.CC.CC.Cc1ccc2c(C)cccc2c1C |
| InChI | InChI=1S/C13H14.3C2H6/c1-9-7-8-12-10(2)5-4-6-13(12)11(9)3;3*1-2/h4-8H,1-3H3;3*1-2H3 |
| InChIKey | TWGPUJAEQYRHST-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.46 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |