About 7-methylchrysene-1-thiol
7-methylchrysene-1-thiol (PubChem CID 143948531) has the molecular formula C19H14S
and a molecular weight of 274.39 g/mol. Its IUPAC name is 7-methylchrysene-1-thiol.
Molecular Properties
| Compound Name | 7-methylchrysene-1-thiol |
| PubChem CID | 143948531 |
| Molecular Formula | C19H14S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 7-methylchrysene-1-thiol |
| SMILES | Cc1cccc2c1ccc1c3cccc(S)c3ccc21 |
| InChI | InChI=1S/C19H14S/c1-12-4-2-5-14-13(12)8-9-17-15-6-3-7-19(20)18(15)11-10-16(14)17/h2-11,20H,1H3 |
| InChIKey | XJVGBGPAIKKIHN-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 7-methylchrysene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylchrysene-1-thiol?
The IUPAC name of 7-methylchrysene-1-thiol (CID 143948531) is 7-methylchrysene-1-thiol.
What is the SMILES notation for 7-methylchrysene-1-thiol?
The canonical SMILES for 7-methylchrysene-1-thiol is Cc1cccc2c1ccc1c3cccc(S)c3ccc21.
What is the InChIKey of 7-methylchrysene-1-thiol?
The InChIKey is XJVGBGPAIKKIHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14S/c1-12-4-2-5-14-13(12)8-9-17-15-6-3-7-19(20)18(15)11-10-16(14)17/h2-11,20H,1H3.
What are the key properties of 7-methylchrysene-1-thiol?
7-methylchrysene-1-thiol has a molecular weight of 274.39 g/mol, XLogP of 5.74, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylchrysene-1-thiol is sourced from PubChem (CID 143948531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).