About 2-methylbenzenethiol;pentahydrofluoride
2-methylbenzenethiol;pentahydrofluoride (PubChem CID 173133348) has the molecular formula C7H13F5S
and a molecular weight of 224.24 g/mol. Its IUPAC name is 2-methylbenzenethiol;pentahydrofluoride.
Molecular Properties
| Compound Name | 2-methylbenzenethiol;pentahydrofluoride |
| PubChem CID | 173133348 |
| Molecular Formula | C7H13F5S |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 2-methylbenzenethiol;pentahydrofluoride |
| SMILES | Cc1ccccc1S.F.F.F.F.F |
| InChI | InChI=1S/C7H8S.5FH/c1-6-4-2-3-5-7(6)8;;;;;/h2-5,8H,1H3;5*1H |
| InChIKey | OLWDEPBVHOZRGH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbenzenethiol;pentahydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbenzenethiol;pentahydrofluoride?
The IUPAC name of 2-methylbenzenethiol;pentahydrofluoride (CID 173133348) is 2-methylbenzenethiol;pentahydrofluoride.
What is the SMILES notation for 2-methylbenzenethiol;pentahydrofluoride?
The canonical SMILES for 2-methylbenzenethiol;pentahydrofluoride is Cc1ccccc1S.F.F.F.F.F.
What is the InChIKey of 2-methylbenzenethiol;pentahydrofluoride?
The InChIKey is OLWDEPBVHOZRGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8S.5FH/c1-6-4-2-3-5-7(6)8;;;;;/h2-5,8H,1H3;5*1H.
What are the key properties of 2-methylbenzenethiol;pentahydrofluoride?
2-methylbenzenethiol;pentahydrofluoride has a molecular weight of 224.24 g/mol, XLogP of 3.05, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbenzenethiol;pentahydrofluoride is sourced from PubChem (CID 173133348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).