C8H10AlS+3 — CID 19021809
aluminum 2,3-dimethylbenzenethiol (PubChem CID 19021809) has the molecular formula C8H10AlS+3 and a molecular weight of 165.22 g/mol. Its IUPAC name is aluminum 2,3-dimethylbenzenethiol.
| Compound Name | aluminum 2,3-dimethylbenzenethiol |
|---|---|
| PubChem CID | 19021809 |
| Molecular Formula | C8H10AlS+3 |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.03 |
| IUPAC Name | aluminum 2,3-dimethylbenzenethiol |
| SMILES | Cc1cccc(S)c1C.[Al+3] |
| InChI | InChI=1S/C8H10S.Al/c1-6-4-3-5-8(9)7(6)2;/h3-5,9H,1-2H3;/q;+3 |
| InChIKey | GLQALBIJHKHRCF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|