About 3-chloro-2-methylbenzenethiol;hydrochloride;tetrahydrofluoride
3-chloro-2-methylbenzenethiol;hydrochloride;tetrahydrofluoride (PubChem CID 173469109) has the molecular formula C7H12Cl2F4S
and a molecular weight of 275.14 g/mol. Its IUPAC name is 3-chloro-2-methylbenzenethiol;hydrochloride;tetrahydrofluoride.
Molecular Properties
| Compound Name | 3-chloro-2-methylbenzenethiol;hydrochloride;tetrahydrofluoride |
| PubChem CID | 173469109 |
| Molecular Formula | C7H12Cl2F4S |
| Molecular Weight | 275.14 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | 3-chloro-2-methylbenzenethiol;hydrochloride;tetrahydrofluoride |
| SMILES | Cc1c(S)cccc1Cl.Cl.F.F.F.F |
| InChI | InChI=1S/C7H7ClS.ClH.4FH/c1-5-6(8)3-2-4-7(5)9;;;;;/h2-4,9H,1H3;5*1H |
| InChIKey | DRVCUDNXJLNXBX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.14 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2-methylbenzenethiol;hydrochloride;tetrahydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-methylbenzenethiol;hydrochloride;tetrahydrofluoride?
The IUPAC name of 3-chloro-2-methylbenzenethiol;hydrochloride;tetrahydrofluoride (CID 173469109) is 3-chloro-2-methylbenzenethiol;hydrochloride;tetrahydrofluoride.
What is the SMILES notation for 3-chloro-2-methylbenzenethiol;hydrochloride;tetrahydrofluoride?
The canonical SMILES for 3-chloro-2-methylbenzenethiol;hydrochloride;tetrahydrofluoride is Cc1c(S)cccc1Cl.Cl.F.F.F.F.
What is the InChIKey of 3-chloro-2-methylbenzenethiol;hydrochloride;tetrahydrofluoride?
The InChIKey is DRVCUDNXJLNXBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClS.ClH.4FH/c1-5-6(8)3-2-4-7(5)9;;;;;/h2-4,9H,1H3;5*1H.
What are the key properties of 3-chloro-2-methylbenzenethiol;hydrochloride;tetrahydrofluoride?
3-chloro-2-methylbenzenethiol;hydrochloride;tetrahydrofluoride has a molecular weight of 275.14 g/mol, XLogP of 3.97, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-methylbenzenethiol;hydrochloride;tetrahydrofluoride is sourced from PubChem (CID 173469109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).