C23H24OS — CID 11631636
bis(2,3-dimethylphenyl)-(2-sulfanylphenyl)methanol (PubChem CID 11631636) has the molecular formula C23H24OS and a molecular weight of 348.51 g/mol. Its IUPAC name is bis(2,3-dimethylphenyl)-(2-sulfanylphenyl)methanol.
| Compound Name | bis(2,3-dimethylphenyl)-(2-sulfanylphenyl)methanol |
|---|---|
| PubChem CID | 11631636 |
| Molecular Formula | C23H24OS |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | bis(2,3-dimethylphenyl)-(2-sulfanylphenyl)methanol |
| SMILES | Cc1cccc(C(O)(c2ccccc2S)c2cccc(C)c2C)c1C |
| InChI | InChI=1S/C23H24OS/c1-15-9-7-12-19(17(15)3)23(24,21-11-5-6-14-22(21)25)20-13-8-10-16(2)18(20)4/h5-14,24-25H,1-4H3 |
| InChIKey | AJMBECQLHQMYBO-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|