C11H13F3O — CID 58543603
2-(2,3-dimethylphenyl)-1,1,1-trifluoropropan-2-ol (PubChem CID 58543603) has the molecular formula C11H13F3O and a molecular weight of 218.22 g/mol. Its IUPAC name is 2-(2,3-dimethylphenyl)-1,1,1-trifluoropropan-2-ol.
| Compound Name | 2-(2,3-dimethylphenyl)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 58543603 |
| Molecular Formula | C11H13F3O |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 2-(2,3-dimethylphenyl)-1,1,1-trifluoropropan-2-ol |
| SMILES | Cc1cccc(C(C)(O)C(F)(F)F)c1C |
| InChI | InChI=1S/C11H13F3O/c1-7-5-4-6-9(8(7)2)10(3,15)11(12,13)14/h4-6,15H,1-3H3 |
| InChIKey | UTMYGNHIPQGHOG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |