acetic acid;2-(2,3-dimethylphenyl)propan-2-amine

C13H21NO2 — CID 173060672

IUPACacetic acid;2-(2,3-dimethylphenyl)propan-2-amine
SMILESCC(=O)O.Cc1cccc(C(C)(C)N)c1C
InChIInChI=1S/C11H17N.C2H4O2/c1-8-6-5-7-10(9(8)2)11(3,4)12;1-2(3)4/h5-7H,12H2,1-4H3;1H3,(H,3,4)
InChIKeyZGFAOLWBZADSGA-UHFFFAOYSA-N
MW223.32 g/mol
LogP2.59
Rot. Bonds1

About acetic acid;2-(2,3-dimethylphenyl)propan-2-amine

acetic acid;2-(2,3-dimethylphenyl)propan-2-amine (PubChem CID 173060672) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is acetic acid;2-(2,3-dimethylphenyl)propan-2-amine.

Molecular Properties

Compound Nameacetic acid;2-(2,3-dimethylphenyl)propan-2-amine
PubChem CID173060672
Molecular FormulaC13H21NO2
Molecular Weight223.32 g/mol
Exact Mass223.16
IUPAC Nameacetic acid;2-(2,3-dimethylphenyl)propan-2-amine
SMILESCC(=O)O.Cc1cccc(C(C)(C)N)c1C
InChIInChI=1S/C11H17N.C2H4O2/c1-8-6-5-7-10(9(8)2)11(3,4)12;1-2(3)4/h5-7H,12H2,1-4H3;1H3,(H,3,4)
InChIKeyZGFAOLWBZADSGA-UHFFFAOYSA-N
XLogP2.59
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.32
LogP ≤ 52.59
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze acetic acid;2-(2,3-dimethylphenyl)propan-2-amine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;2-(2,3-dimethylphenyl)propan-2-amine?
The IUPAC name of acetic acid;2-(2,3-dimethylphenyl)propan-2-amine (CID 173060672) is acetic acid;2-(2,3-dimethylphenyl)propan-2-amine.
What is the SMILES notation for acetic acid;2-(2,3-dimethylphenyl)propan-2-amine?
The canonical SMILES for acetic acid;2-(2,3-dimethylphenyl)propan-2-amine is CC(=O)O.Cc1cccc(C(C)(C)N)c1C.
What is the InChIKey of acetic acid;2-(2,3-dimethylphenyl)propan-2-amine?
The InChIKey is ZGFAOLWBZADSGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N.C2H4O2/c1-8-6-5-7-10(9(8)2)11(3,4)12;1-2(3)4/h5-7H,12H2,1-4H3;1H3,(H,3,4).
What are the key properties of acetic acid;2-(2,3-dimethylphenyl)propan-2-amine?
acetic acid;2-(2,3-dimethylphenyl)propan-2-amine has a molecular weight of 223.32 g/mol, XLogP of 2.59, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-(2,3-dimethylphenyl)propan-2-amine is sourced from PubChem (CID 173060672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).