C13H21NO2 — CID 173060672
acetic acid;2-(2,3-dimethylphenyl)propan-2-amine (PubChem CID 173060672) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is acetic acid;2-(2,3-dimethylphenyl)propan-2-amine.
| Compound Name | acetic acid;2-(2,3-dimethylphenyl)propan-2-amine |
|---|---|
| PubChem CID | 173060672 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | acetic acid;2-(2,3-dimethylphenyl)propan-2-amine |
| SMILES | CC(=O)O.Cc1cccc(C(C)(C)N)c1C |
| InChI | InChI=1S/C11H17N.C2H4O2/c1-8-6-5-7-10(9(8)2)11(3,4)12;1-2(3)4/h5-7H,12H2,1-4H3;1H3,(H,3,4) |
| InChIKey | ZGFAOLWBZADSGA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |