About 2-chloroacetic acid;2-(2-methylphenyl)propan-2-amine
2-chloroacetic acid;2-(2-methylphenyl)propan-2-amine (PubChem CID 173188958) has the molecular formula C12H18ClNO2
and a molecular weight of 243.73 g/mol. Its IUPAC name is 2-chloroacetic acid;2-(2-methylphenyl)propan-2-amine.
Molecular Properties
| Compound Name | 2-chloroacetic acid;2-(2-methylphenyl)propan-2-amine |
| PubChem CID | 173188958 |
| Molecular Formula | C12H18ClNO2 |
| Molecular Weight | 243.73 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 2-chloroacetic acid;2-(2-methylphenyl)propan-2-amine |
| SMILES | Cc1ccccc1C(C)(C)N.O=C(O)CCl |
| InChI | InChI=1S/C10H15N.C2H3ClO2/c1-8-6-4-5-7-9(8)10(2,3)11;3-1-2(4)5/h4-7H,11H2,1-3H3;1H2,(H,4,5) |
| InChIKey | BZESSJWTRIMFCH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.73 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroacetic acid;2-(2-methylphenyl)propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroacetic acid;2-(2-methylphenyl)propan-2-amine?
The IUPAC name of 2-chloroacetic acid;2-(2-methylphenyl)propan-2-amine (CID 173188958) is 2-chloroacetic acid;2-(2-methylphenyl)propan-2-amine.
What is the SMILES notation for 2-chloroacetic acid;2-(2-methylphenyl)propan-2-amine?
The canonical SMILES for 2-chloroacetic acid;2-(2-methylphenyl)propan-2-amine is Cc1ccccc1C(C)(C)N.O=C(O)CCl.
What is the InChIKey of 2-chloroacetic acid;2-(2-methylphenyl)propan-2-amine?
The InChIKey is BZESSJWTRIMFCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N.C2H3ClO2/c1-8-6-4-5-7-9(8)10(2,3)11;3-1-2(4)5/h4-7H,11H2,1-3H3;1H2,(H,4,5).
What are the key properties of 2-chloroacetic acid;2-(2-methylphenyl)propan-2-amine?
2-chloroacetic acid;2-(2-methylphenyl)propan-2-amine has a molecular weight of 243.73 g/mol, XLogP of 2.50, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroacetic acid;2-(2-methylphenyl)propan-2-amine is sourced from PubChem (CID 173188958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).