C23H38N2O3 — CID 173415896
2-(cyclohexylcarbamoyl)-2-ethylbutanoic acid;2-(2-methylphenyl)propan-2-amine (PubChem CID 173415896) has the molecular formula C23H38N2O3 and a molecular weight of 390.57 g/mol. Its IUPAC name is 2-(cyclohexylcarbamoyl)-2-ethylbutanoic acid;2-(2-methylphenyl)propan-2-amine.
| Compound Name | 2-(cyclohexylcarbamoyl)-2-ethylbutanoic acid;2-(2-methylphenyl)propan-2-amine |
|---|---|
| PubChem CID | 173415896 |
| Molecular Formula | C23H38N2O3 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.29 |
| IUPAC Name | 2-(cyclohexylcarbamoyl)-2-ethylbutanoic acid;2-(2-methylphenyl)propan-2-amine |
| SMILES | CCC(CC)(C(=O)O)C(=O)NC1CCCCC1.Cc1ccccc1C(C)(C)N |
| InChI | InChI=1S/C13H23NO3.C10H15N/c1-3-13(4-2,12(16)17)11(15)14-10-8-6-5-7-9-10;1-8-6-4-5-7-9(8)10(2,3)11/h10H,3-9H2,1-2H3,(H,14,15)(H,16,17);4-7H,11H2,1-3H3 |
| InChIKey | ZEBAZIXTCMISFS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|