C17H25NO2 — CID 177440145
(3R)-N-cyclohexyl-3-hydroxy-2,2-dimethyl-3-phenylpropanamide (PubChem CID 177440145) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is (3R)-N-cyclohexyl-3-hydroxy-2,2-dimethyl-3-phenylpropanamide.
| Compound Name | (3R)-N-cyclohexyl-3-hydroxy-2,2-dimethyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 177440145 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | (3R)-N-cyclohexyl-3-hydroxy-2,2-dimethyl-3-phenylpropanamide |
| SMILES | CC(C)(C(=O)NC1CCCCC1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C17H25NO2/c1-17(2,15(19)13-9-5-3-6-10-13)16(20)18-14-11-7-4-8-12-14/h3,5-6,9-10,14-15,19H,4,7-8,11-12H2,1-2H3,(H,18,20)/t15-/m1/s1 |
| InChIKey | HCLHZQKMNBPFEM-OAHLLOKOSA-N |
| XLogP | 3.20 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |