C28H38N4O2 — CID 15231966
1-cyclohexyl-3-[2-(cyclohexylcarbamoylamino)-1,2-diphenylethyl]urea (PubChem CID 15231966) has the molecular formula C28H38N4O2 and a molecular weight of 462.64 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-(cyclohexylcarbamoylamino)-1,2-diphenylethyl]urea.
| Compound Name | 1-cyclohexyl-3-[2-(cyclohexylcarbamoylamino)-1,2-diphenylethyl]urea |
|---|---|
| PubChem CID | 15231966 |
| Molecular Formula | C28H38N4O2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | 1-cyclohexyl-3-[2-(cyclohexylcarbamoylamino)-1,2-diphenylethyl]urea |
| SMILES | O=C(NC1CCCCC1)NC(c1ccccc1)C(NC(=O)NC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C28H38N4O2/c33-27(29-23-17-9-3-10-18-23)31-25(21-13-5-1-6-14-21)26(22-15-7-2-8-16-22)32-28(34)30-24-19-11-4-12-20-24/h1-2,5-8,13-16,23-26H,3-4,9-12,17-20H2,(H2,29,31,33)(H2,30,32,34) |
| InChIKey | CXZPXZZKQZTCOY-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |