C16H20F2N2O2 — CID 102287753
N-cyclohexyl-2,2-difluoro-3-formamido-3-phenylpropanamide (PubChem CID 102287753) has the molecular formula C16H20F2N2O2 and a molecular weight of 310.34 g/mol. Its IUPAC name is N-cyclohexyl-2,2-difluoro-3-formamido-3-phenylpropanamide.
| Compound Name | N-cyclohexyl-2,2-difluoro-3-formamido-3-phenylpropanamide |
|---|---|
| PubChem CID | 102287753 |
| Molecular Formula | C16H20F2N2O2 |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | N-cyclohexyl-2,2-difluoro-3-formamido-3-phenylpropanamide |
| SMILES | O=CNC(c1ccccc1)C(F)(F)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C16H20F2N2O2/c17-16(18,15(22)20-13-9-5-2-6-10-13)14(19-11-21)12-7-3-1-4-8-12/h1,3-4,7-8,11,13-14H,2,5-6,9-10H2,(H,19,21)(H,20,22) |
| InChIKey | MWVJTRSINJOKBL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|