C24H28N4O4 — CID 167001986
(2S)-2-formamido-N-[4-[[(2R)-2-formamido-2-phenylacetyl]amino]cyclohexyl]-2-phenylacetamide (PubChem CID 167001986) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is (2S)-2-formamido-N-[4-[[(2R)-2-formamido-2-phenylacetyl]amino]cyclohexyl]-2-phenylacetamide.
| Compound Name | (2S)-2-formamido-N-[4-[[(2R)-2-formamido-2-phenylacetyl]amino]cyclohexyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 167001986 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | (2S)-2-formamido-N-[4-[[(2R)-2-formamido-2-phenylacetyl]amino]cyclohexyl]-2-phenylacetamide |
| SMILES | O=CN[C@H](C(=O)NC1CCC(NC(=O)[C@H](NC=O)c2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C24H28N4O4/c29-15-25-21(17-7-3-1-4-8-17)23(31)27-19-11-13-20(14-12-19)28-24(32)22(26-16-30)18-9-5-2-6-10-18/h1-10,15-16,19-22H,11-14H2,(H,25,29)(H,26,30)(H,27,31)(H,28,32)/t19?,20?,21-,22+ |
| InChIKey | JFLRGMITQKBRLL-JQBYJRRVSA-N |
| XLogP | 1.50 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|