C17H16F2N2O — CID 51248536
N-cyclopropyl-2-(3,4-difluoroanilino)-2-phenylacetamide (PubChem CID 51248536) has the molecular formula C17H16F2N2O and a molecular weight of 302.32 g/mol. Its IUPAC name is N-cyclopropyl-2-(3,4-difluoroanilino)-2-phenylacetamide.
| Compound Name | N-cyclopropyl-2-(3,4-difluoroanilino)-2-phenylacetamide |
|---|---|
| PubChem CID | 51248536 |
| Molecular Formula | C17H16F2N2O |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | N-cyclopropyl-2-(3,4-difluoroanilino)-2-phenylacetamide |
| SMILES | O=C(NC1CC1)C(Nc1ccc(F)c(F)c1)c1ccccc1 |
| InChI | InChI=1S/C17H16F2N2O/c18-14-9-8-13(10-15(14)19)20-16(11-4-2-1-3-5-11)17(22)21-12-6-7-12/h1-5,8-10,12,16,20H,6-7H2,(H,21,22) |
| InChIKey | MBUQLEDXRQVVNC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |