C19H22N2O3 — CID 94796172
(2S)-N-cyclopropyl-2-[3-(hydroxymethyl)-4-methoxyanilino]-2-phenylacetamide (PubChem CID 94796172) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is (2S)-N-cyclopropyl-2-[3-(hydroxymethyl)-4-methoxyanilino]-2-phenylacetamide.
| Compound Name | (2S)-N-cyclopropyl-2-[3-(hydroxymethyl)-4-methoxyanilino]-2-phenylacetamide |
|---|---|
| PubChem CID | 94796172 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | (2S)-N-cyclopropyl-2-[3-(hydroxymethyl)-4-methoxyanilino]-2-phenylacetamide |
| SMILES | COc1ccc(N[C@H](C(=O)NC2CC2)c2ccccc2)cc1CO |
| InChI | InChI=1S/C19H22N2O3/c1-24-17-10-9-16(11-14(17)12-22)20-18(13-5-3-2-4-6-13)19(23)21-15-7-8-15/h2-6,9-11,15,18,20,22H,7-8,12H2,1H3,(H,21,23)/t18-/m0/s1 |
| InChIKey | KWMRYQCXQAZYRM-SFHVURJKSA-N |
| XLogP | 2.62 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|