C15H14N2O2 — CID 167282535
(2R)-2-formamido-N,2-diphenylacetamide (PubChem CID 167282535) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is (2R)-2-formamido-N,2-diphenylacetamide.
| Compound Name | (2R)-2-formamido-N,2-diphenylacetamide |
|---|---|
| PubChem CID | 167282535 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | (2R)-2-formamido-N,2-diphenylacetamide |
| SMILES | O=CN[C@@H](C(=O)Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H14N2O2/c18-11-16-14(12-7-3-1-4-8-12)15(19)17-13-9-5-2-6-10-13/h1-11,14H,(H,16,18)(H,17,19)/t14-/m1/s1 |
| InChIKey | OVAHFZNRUYLJNC-CQSZACIVSA-N |
| XLogP | 2.11 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|