C21H20N2O — CID 101449959
(2R)-2-(benzylamino)-N,2-diphenylacetamide (PubChem CID 101449959) has the molecular formula C21H20N2O and a molecular weight of 316.40 g/mol. Its IUPAC name is (2R)-2-(benzylamino)-N,2-diphenylacetamide.
| Compound Name | (2R)-2-(benzylamino)-N,2-diphenylacetamide |
|---|---|
| PubChem CID | 101449959 |
| Molecular Formula | C21H20N2O |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | (2R)-2-(benzylamino)-N,2-diphenylacetamide |
| SMILES | O=C(Nc1ccccc1)[C@H](NCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H20N2O/c24-21(23-19-14-8-3-9-15-19)20(18-12-6-2-7-13-18)22-16-17-10-4-1-5-11-17/h1-15,20,22H,16H2,(H,23,24)/t20-/m1/s1 |
| InChIKey | HZHRGPYKLBEBPP-HXUWFJFHSA-N |
| XLogP | 4.16 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |