C22H22N2OS — CID 9051615
(2R)-N-cyclopropyl-2-phenyl-2-[[(S)-phenyl(thiophen-2-yl)methyl]amino]acetamide (PubChem CID 9051615) has the molecular formula C22H22N2OS and a molecular weight of 362.50 g/mol. Its IUPAC name is (2R)-N-cyclopropyl-2-phenyl-2-[[(S)-phenyl(thiophen-2-yl)methyl]amino]acetamide.
| Compound Name | (2R)-N-cyclopropyl-2-phenyl-2-[[(S)-phenyl(thiophen-2-yl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 9051615 |
| Molecular Formula | C22H22N2OS |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | (2R)-N-cyclopropyl-2-phenyl-2-[[(S)-phenyl(thiophen-2-yl)methyl]amino]acetamide |
| SMILES | O=C(NC1CC1)[C@H](N[C@@H](c1ccccc1)c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C22H22N2OS/c25-22(23-18-13-14-18)21(17-10-5-2-6-11-17)24-20(19-12-7-15-26-19)16-8-3-1-4-9-16/h1-12,15,18,20-21,24H,13-14H2,(H,23,25)/t20-,21+/m0/s1 |
| InChIKey | BEBXEBPUEJEBRC-LEWJYISDSA-N |
| XLogP | 4.45 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |