C19H24N2OS — CID 8769306
(2R)-N-cyclopropyl-2-[[(S)-(4-ethylphenyl)-thiophen-2-ylmethyl]amino]propanamide (PubChem CID 8769306) has the molecular formula C19H24N2OS and a molecular weight of 328.48 g/mol. Its IUPAC name is (2R)-N-cyclopropyl-2-[[(S)-(4-ethylphenyl)-thiophen-2-ylmethyl]amino]propanamide.
| Compound Name | (2R)-N-cyclopropyl-2-[[(S)-(4-ethylphenyl)-thiophen-2-ylmethyl]amino]propanamide |
|---|---|
| PubChem CID | 8769306 |
| Molecular Formula | C19H24N2OS |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (2R)-N-cyclopropyl-2-[[(S)-(4-ethylphenyl)-thiophen-2-ylmethyl]amino]propanamide |
| SMILES | CCc1ccc([C@H](N[C@H](C)C(=O)NC2CC2)c2cccs2)cc1 |
| InChI | InChI=1S/C19H24N2OS/c1-3-14-6-8-15(9-7-14)18(17-5-4-12-23-17)20-13(2)19(22)21-16-10-11-16/h4-9,12-13,16,18,20H,3,10-11H2,1-2H3,(H,21,22)/t13-,18+/m1/s1 |
| InChIKey | XUBOASVSDCJDHF-ACJLOTCBSA-N |
| XLogP | 3.66 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |