C21H25FN2O — CID 8829973
(2R)-N-cyclopropyl-2-[[(S)-(4-ethylphenyl)-(3-fluorophenyl)methyl]amino]propanamide (PubChem CID 8829973) has the molecular formula C21H25FN2O and a molecular weight of 340.44 g/mol. Its IUPAC name is (2R)-N-cyclopropyl-2-[[(S)-(4-ethylphenyl)-(3-fluorophenyl)methyl]amino]propanamide.
| Compound Name | (2R)-N-cyclopropyl-2-[[(S)-(4-ethylphenyl)-(3-fluorophenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 8829973 |
| Molecular Formula | C21H25FN2O |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (2R)-N-cyclopropyl-2-[[(S)-(4-ethylphenyl)-(3-fluorophenyl)methyl]amino]propanamide |
| SMILES | CCc1ccc([C@H](N[C@H](C)C(=O)NC2CC2)c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C21H25FN2O/c1-3-15-7-9-16(10-8-15)20(17-5-4-6-18(22)13-17)23-14(2)21(25)24-19-11-12-19/h4-10,13-14,19-20,23H,3,11-12H2,1-2H3,(H,24,25)/t14-,20+/m1/s1 |
| InChIKey | ZPRHAOZIPKULSI-VLIAUNLRSA-N |
| XLogP | 3.73 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |