C20H22F2N2O2 — CID 8830559
(2S)-N-cyclopropyl-2-[[(R)-[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]propanamide (PubChem CID 8830559) has the molecular formula C20H22F2N2O2 and a molecular weight of 360.40 g/mol. Its IUPAC name is (2S)-N-cyclopropyl-2-[[(R)-[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]propanamide.
| Compound Name | (2S)-N-cyclopropyl-2-[[(R)-[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]propanamide |
|---|---|
| PubChem CID | 8830559 |
| Molecular Formula | C20H22F2N2O2 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (2S)-N-cyclopropyl-2-[[(R)-[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]propanamide |
| SMILES | C[C@H](N[C@H](c1ccccc1)c1ccc(OC(F)F)cc1)C(=O)NC1CC1 |
| InChI | InChI=1S/C20H22F2N2O2/c1-13(19(25)24-16-9-10-16)23-18(14-5-3-2-4-6-14)15-7-11-17(12-8-15)26-20(21)22/h2-8,11-13,16,18,20,23H,9-10H2,1H3,(H,24,25)/t13-,18+/m0/s1 |
| InChIKey | NPIJATIWMNDNTO-SCLBCKFNSA-N |
| XLogP | 3.63 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |