C14H15F2NO4 — CID 4876666
[1-(cyclopropylamino)-1-oxopropan-2-yl] 4-(difluoromethoxy)benzoate (PubChem CID 4876666) has the molecular formula C14H15F2NO4 and a molecular weight of 299.27 g/mol. Its IUPAC name is [1-(cyclopropylamino)-1-oxopropan-2-yl] 4-(difluoromethoxy)benzoate.
| Compound Name | [1-(cyclopropylamino)-1-oxopropan-2-yl] 4-(difluoromethoxy)benzoate |
|---|---|
| PubChem CID | 4876666 |
| Molecular Formula | C14H15F2NO4 |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | [1-(cyclopropylamino)-1-oxopropan-2-yl] 4-(difluoromethoxy)benzoate |
| SMILES | CC(OC(=O)c1ccc(OC(F)F)cc1)C(=O)NC1CC1 |
| InChI | InChI=1S/C14H15F2NO4/c1-8(12(18)17-10-4-5-10)20-13(19)9-2-6-11(7-3-9)21-14(15)16/h2-3,6-8,10,14H,4-5H2,1H3,(H,17,18) |
| InChIKey | YEKDPKRWXWVZIS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |