C14H17NO4 — CID 7507003
[(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 4-methoxybenzoate (PubChem CID 7507003) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 4-methoxybenzoate.
| Compound Name | [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 7507003 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)O[C@@H](C)C(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C14H17NO4/c1-9(13(16)15-11-5-6-11)19-14(17)10-3-7-12(18-2)8-4-10/h3-4,7-9,11H,5-6H2,1-2H3,(H,15,16)/t9-/m0/s1 |
| InChIKey | KHWXRFMRBNHUBY-VIFPVBQESA-N |
| XLogP | 1.52 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |