C18H18F2N2OS — CID 9282980
1-cyclopropyl-3-[(S)-[4-(difluoromethoxy)phenyl]-phenylmethyl]thiourea (PubChem CID 9282980) has the molecular formula C18H18F2N2OS and a molecular weight of 348.42 g/mol. Its IUPAC name is 1-cyclopropyl-3-[(S)-[4-(difluoromethoxy)phenyl]-phenylmethyl]thiourea.
| Compound Name | 1-cyclopropyl-3-[(S)-[4-(difluoromethoxy)phenyl]-phenylmethyl]thiourea |
|---|---|
| PubChem CID | 9282980 |
| Molecular Formula | C18H18F2N2OS |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 1-cyclopropyl-3-[(S)-[4-(difluoromethoxy)phenyl]-phenylmethyl]thiourea |
| SMILES | FC(F)Oc1ccc([C@@H](NC(=S)NC2CC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H18F2N2OS/c19-17(20)23-15-10-6-13(7-11-15)16(12-4-2-1-3-5-12)22-18(24)21-14-8-9-14/h1-7,10-11,14,16-17H,8-9H2,(H2,21,22,24)/t16-/m0/s1 |
| InChIKey | CWXDHGYGFYEBRO-INIZCTEOSA-N |
| XLogP | 4.00 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|