C16H18N2S2 — CID 9283733
1-cyclopropyl-3-[(R)-(4-methylphenyl)-thiophen-2-ylmethyl]thiourea (PubChem CID 9283733) has the molecular formula C16H18N2S2 and a molecular weight of 302.47 g/mol. Its IUPAC name is 1-cyclopropyl-3-[(R)-(4-methylphenyl)-thiophen-2-ylmethyl]thiourea.
| Compound Name | 1-cyclopropyl-3-[(R)-(4-methylphenyl)-thiophen-2-ylmethyl]thiourea |
|---|---|
| PubChem CID | 9283733 |
| Molecular Formula | C16H18N2S2 |
| Molecular Weight | 302.47 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 1-cyclopropyl-3-[(R)-(4-methylphenyl)-thiophen-2-ylmethyl]thiourea |
| SMILES | Cc1ccc([C@@H](NC(=S)NC2CC2)c2cccs2)cc1 |
| InChI | InChI=1S/C16H18N2S2/c1-11-4-6-12(7-5-11)15(14-3-2-10-20-14)18-16(19)17-13-8-9-13/h2-7,10,13,15H,8-9H2,1H3,(H2,17,18,19)/t15-/m1/s1 |
| InChIKey | VZRZLBTZWLFMMG-OAHLLOKOSA-N |
| XLogP | 3.77 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|