C19H17FN2OS — CID 17499433
1-(4-fluorophenyl)-3-[(4-methylphenyl)-thiophen-2-ylmethyl]urea (PubChem CID 17499433) has the molecular formula C19H17FN2OS and a molecular weight of 340.42 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[(4-methylphenyl)-thiophen-2-ylmethyl]urea.
| Compound Name | 1-(4-fluorophenyl)-3-[(4-methylphenyl)-thiophen-2-ylmethyl]urea |
|---|---|
| PubChem CID | 17499433 |
| Molecular Formula | C19H17FN2OS |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[(4-methylphenyl)-thiophen-2-ylmethyl]urea |
| SMILES | Cc1ccc(C(NC(=O)Nc2ccc(F)cc2)c2cccs2)cc1 |
| InChI | InChI=1S/C19H17FN2OS/c1-13-4-6-14(7-5-13)18(17-3-2-12-24-17)22-19(23)21-16-10-8-15(20)9-11-16/h2-12,18H,1H3,(H2,21,22,23) |
| InChIKey | RNKOKHNVSOIQKB-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |