C23H25N3O2S — CID 9051950
(2S)-N-(4-acetamidophenyl)-2-[[(R)-(4-methylphenyl)-thiophen-2-ylmethyl]amino]propanamide (PubChem CID 9051950) has the molecular formula C23H25N3O2S and a molecular weight of 407.54 g/mol. Its IUPAC name is (2S)-N-(4-acetamidophenyl)-2-[[(R)-(4-methylphenyl)-thiophen-2-ylmethyl]amino]propanamide.
| Compound Name | (2S)-N-(4-acetamidophenyl)-2-[[(R)-(4-methylphenyl)-thiophen-2-ylmethyl]amino]propanamide |
|---|---|
| PubChem CID | 9051950 |
| Molecular Formula | C23H25N3O2S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | (2S)-N-(4-acetamidophenyl)-2-[[(R)-(4-methylphenyl)-thiophen-2-ylmethyl]amino]propanamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)[C@H](C)N[C@H](c2ccc(C)cc2)c2cccs2)cc1 |
| InChI | InChI=1S/C23H25N3O2S/c1-15-6-8-18(9-7-15)22(21-5-4-14-29-21)24-16(2)23(28)26-20-12-10-19(11-13-20)25-17(3)27/h4-14,16,22,24H,1-3H3,(H,25,27)(H,26,28)/t16-,22+/m0/s1 |
| InChIKey | RNTUBFJUBFMMLQ-KSFYIVLOSA-N |
| XLogP | 4.72 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |