C22H24N2OS — CID 9052277
(2S)-N-(3-methylphenyl)-2-[[(S)-(4-methylphenyl)-thiophen-2-ylmethyl]amino]propanamide (PubChem CID 9052277) has the molecular formula C22H24N2OS and a molecular weight of 364.51 g/mol. Its IUPAC name is (2S)-N-(3-methylphenyl)-2-[[(S)-(4-methylphenyl)-thiophen-2-ylmethyl]amino]propanamide.
| Compound Name | (2S)-N-(3-methylphenyl)-2-[[(S)-(4-methylphenyl)-thiophen-2-ylmethyl]amino]propanamide |
|---|---|
| PubChem CID | 9052277 |
| Molecular Formula | C22H24N2OS |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | (2S)-N-(3-methylphenyl)-2-[[(S)-(4-methylphenyl)-thiophen-2-ylmethyl]amino]propanamide |
| SMILES | Cc1ccc([C@H](N[C@@H](C)C(=O)Nc2cccc(C)c2)c2cccs2)cc1 |
| InChI | InChI=1S/C22H24N2OS/c1-15-9-11-18(12-10-15)21(20-8-5-13-26-20)23-17(3)22(25)24-19-7-4-6-16(2)14-19/h4-14,17,21,23H,1-3H3,(H,24,25)/t17-,21-/m0/s1 |
| InChIKey | DIFLKWALUOUFLI-UWJYYQICSA-N |
| XLogP | 5.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |