C23H24N2O2S — CID 9051976
(2R)-N-(3-acetylphenyl)-2-[[(R)-(4-methylphenyl)-thiophen-2-ylmethyl]amino]propanamide (PubChem CID 9051976) has the molecular formula C23H24N2O2S and a molecular weight of 392.52 g/mol. Its IUPAC name is (2R)-N-(3-acetylphenyl)-2-[[(R)-(4-methylphenyl)-thiophen-2-ylmethyl]amino]propanamide.
| Compound Name | (2R)-N-(3-acetylphenyl)-2-[[(R)-(4-methylphenyl)-thiophen-2-ylmethyl]amino]propanamide |
|---|---|
| PubChem CID | 9051976 |
| Molecular Formula | C23H24N2O2S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | (2R)-N-(3-acetylphenyl)-2-[[(R)-(4-methylphenyl)-thiophen-2-ylmethyl]amino]propanamide |
| SMILES | CC(=O)c1cccc(NC(=O)[C@@H](C)N[C@H](c2ccc(C)cc2)c2cccs2)c1 |
| InChI | InChI=1S/C23H24N2O2S/c1-15-9-11-18(12-10-15)22(21-8-5-13-28-21)24-16(2)23(27)25-20-7-4-6-19(14-20)17(3)26/h4-14,16,22,24H,1-3H3,(H,25,27)/t16-,22-/m1/s1 |
| InChIKey | XSBFPEWFLZTTGM-OPAMFIHVSA-N |
| XLogP | 4.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |