C20H19ClN2OS — CID 9051206
(2R)-N-(4-chlorophenyl)-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]propanamide (PubChem CID 9051206) has the molecular formula C20H19ClN2OS and a molecular weight of 370.91 g/mol. Its IUPAC name is (2R)-N-(4-chlorophenyl)-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]propanamide.
| Compound Name | (2R)-N-(4-chlorophenyl)-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 9051206 |
| Molecular Formula | C20H19ClN2OS |
| Molecular Weight | 370.91 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | (2R)-N-(4-chlorophenyl)-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]propanamide |
| SMILES | C[C@@H](N[C@H](c1ccccc1)c1cccs1)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H19ClN2OS/c1-14(20(24)23-17-11-9-16(21)10-12-17)22-19(18-8-5-13-25-18)15-6-3-2-4-7-15/h2-14,19,22H,1H3,(H,23,24)/t14-,19-/m1/s1 |
| InChIKey | LNNGKKOVCOLVFL-AUUYWEPGSA-N |
| XLogP | 5.11 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.91 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |