C24H27N3O2S — CID 9030001
(2S)-N-(4-morpholin-4-ylphenyl)-2-[[(S)-phenyl(thiophen-2-yl)methyl]amino]propanamide (PubChem CID 9030001) has the molecular formula C24H27N3O2S and a molecular weight of 421.57 g/mol. Its IUPAC name is (2S)-N-(4-morpholin-4-ylphenyl)-2-[[(S)-phenyl(thiophen-2-yl)methyl]amino]propanamide.
| Compound Name | (2S)-N-(4-morpholin-4-ylphenyl)-2-[[(S)-phenyl(thiophen-2-yl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 9030001 |
| Molecular Formula | C24H27N3O2S |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | (2S)-N-(4-morpholin-4-ylphenyl)-2-[[(S)-phenyl(thiophen-2-yl)methyl]amino]propanamide |
| SMILES | C[C@H](N[C@@H](c1ccccc1)c1cccs1)C(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H27N3O2S/c1-18(25-23(22-8-5-17-30-22)19-6-3-2-4-7-19)24(28)26-20-9-11-21(12-10-20)27-13-15-29-16-14-27/h2-12,17-18,23,25H,13-16H2,1H3,(H,26,28)/t18-,23-/m0/s1 |
| InChIKey | DHHRHPPXRPFARM-MBSDFSHPSA-N |
| XLogP | 4.29 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|