C16H20N2S2 — CID 9283722
1-[(S)-(4-methylphenyl)-thiophen-2-ylmethyl]-3-propylthiourea (PubChem CID 9283722) has the molecular formula C16H20N2S2 and a molecular weight of 304.48 g/mol. Its IUPAC name is 1-[(S)-(4-methylphenyl)-thiophen-2-ylmethyl]-3-propylthiourea.
| Compound Name | 1-[(S)-(4-methylphenyl)-thiophen-2-ylmethyl]-3-propylthiourea |
|---|---|
| PubChem CID | 9283722 |
| Molecular Formula | C16H20N2S2 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 1-[(S)-(4-methylphenyl)-thiophen-2-ylmethyl]-3-propylthiourea |
| SMILES | CCCNC(=S)N[C@@H](c1ccc(C)cc1)c1cccs1 |
| InChI | InChI=1S/C16H20N2S2/c1-3-10-17-16(19)18-15(14-5-4-11-20-14)13-8-6-12(2)7-9-13/h4-9,11,15H,3,10H2,1-2H3,(H2,17,18,19)/t15-/m0/s1 |
| InChIKey | LOOVDZMBRWNOEN-HNNXBMFYSA-N |
| XLogP | 4.02 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|