C21H22N2OS2 — CID 9283736
1-[(4-methoxyphenyl)methyl]-3-[(S)-(4-methylphenyl)-thiophen-2-ylmethyl]thiourea (PubChem CID 9283736) has the molecular formula C21H22N2OS2 and a molecular weight of 382.55 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-3-[(S)-(4-methylphenyl)-thiophen-2-ylmethyl]thiourea.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-3-[(S)-(4-methylphenyl)-thiophen-2-ylmethyl]thiourea |
|---|---|
| PubChem CID | 9283736 |
| Molecular Formula | C21H22N2OS2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-3-[(S)-(4-methylphenyl)-thiophen-2-ylmethyl]thiourea |
| SMILES | COc1ccc(CNC(=S)N[C@@H](c2ccc(C)cc2)c2cccs2)cc1 |
| InChI | InChI=1S/C21H22N2OS2/c1-15-5-9-17(10-6-15)20(19-4-3-13-26-19)23-21(25)22-14-16-7-11-18(24-2)12-8-16/h3-13,20H,14H2,1-2H3,(H2,22,23,25)/t20-/m0/s1 |
| InChIKey | WQPPDVHYPCJNQA-FQEVSTJZSA-N |
| XLogP | 4.82 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|