C20H28N3OS2+ — CID 9096355
1-[(S)-(4-ethylphenyl)-thiophen-2-ylmethyl]-3-(2-morpholin-4-ium-4-ylethyl)thiourea (PubChem CID 9096355) has the molecular formula C20H28N3OS2+ and a molecular weight of 390.60 g/mol. Its IUPAC name is 1-[(S)-(4-ethylphenyl)-thiophen-2-ylmethyl]-3-(2-morpholin-4-ium-4-ylethyl)thiourea.
| Compound Name | 1-[(S)-(4-ethylphenyl)-thiophen-2-ylmethyl]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 9096355 |
| Molecular Formula | C20H28N3OS2+ |
| Molecular Weight | 390.60 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 1-[(S)-(4-ethylphenyl)-thiophen-2-ylmethyl]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
| SMILES | CCc1ccc([C@H](NC(=S)NCC[NH+]2CCOCC2)c2cccs2)cc1 |
| InChI | InChI=1S/C20H27N3OS2/c1-2-16-5-7-17(8-6-16)19(18-4-3-15-26-18)22-20(25)21-9-10-23-11-13-24-14-12-23/h3-8,15,19H,2,9-14H2,1H3,(H2,21,22,25)/p+1/t19-/m0/s1 |
| InChIKey | VDBXTWWAQDAYTL-IBGZPJMESA-O |
| XLogP | 1.78 |
| TPSA | 37.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.60 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|