C20H21NO2S — CID 46449917
N-[(4-ethylphenyl)-thiophen-2-ylmethyl]-3-(furan-2-yl)propanamide (PubChem CID 46449917) has the molecular formula C20H21NO2S and a molecular weight of 339.46 g/mol. Its IUPAC name is N-[(4-ethylphenyl)-thiophen-2-ylmethyl]-3-(furan-2-yl)propanamide.
| Compound Name | N-[(4-ethylphenyl)-thiophen-2-ylmethyl]-3-(furan-2-yl)propanamide |
|---|---|
| PubChem CID | 46449917 |
| Molecular Formula | C20H21NO2S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N-[(4-ethylphenyl)-thiophen-2-ylmethyl]-3-(furan-2-yl)propanamide |
| SMILES | CCc1ccc(C(NC(=O)CCc2ccco2)c2cccs2)cc1 |
| InChI | InChI=1S/C20H21NO2S/c1-2-15-7-9-16(10-8-15)20(18-6-4-14-24-18)21-19(22)12-11-17-5-3-13-23-17/h3-10,13-14,20H,2,11-12H2,1H3,(H,21,22) |
| InChIKey | YLHHUAOFOTZRDQ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |