C13H15NO2S — CID 43005308
3-(furan-2-yl)-N-(1-thiophen-2-ylethyl)propanamide (PubChem CID 43005308) has the molecular formula C13H15NO2S and a molecular weight of 249.34 g/mol. Its IUPAC name is 3-(furan-2-yl)-N-(1-thiophen-2-ylethyl)propanamide.
| Compound Name | 3-(furan-2-yl)-N-(1-thiophen-2-ylethyl)propanamide |
|---|---|
| PubChem CID | 43005308 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 3-(furan-2-yl)-N-(1-thiophen-2-ylethyl)propanamide |
| SMILES | CC(NC(=O)CCc1ccco1)c1cccs1 |
| InChI | InChI=1S/C13H15NO2S/c1-10(12-5-3-9-17-12)14-13(15)7-6-11-4-2-8-16-11/h2-5,8-10H,6-7H2,1H3,(H,14,15) |
| InChIKey | XBYQMDHHHOKCTQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |