C18H16FNO2S — CID 25398079
N-[(S)-(4-fluorophenyl)-thiophen-2-ylmethyl]-3-(furan-2-yl)propanamide (PubChem CID 25398079) has the molecular formula C18H16FNO2S and a molecular weight of 329.40 g/mol. Its IUPAC name is N-[(S)-(4-fluorophenyl)-thiophen-2-ylmethyl]-3-(furan-2-yl)propanamide.
| Compound Name | N-[(S)-(4-fluorophenyl)-thiophen-2-ylmethyl]-3-(furan-2-yl)propanamide |
|---|---|
| PubChem CID | 25398079 |
| Molecular Formula | C18H16FNO2S |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | N-[(S)-(4-fluorophenyl)-thiophen-2-ylmethyl]-3-(furan-2-yl)propanamide |
| SMILES | O=C(CCc1ccco1)N[C@@H](c1ccc(F)cc1)c1cccs1 |
| InChI | InChI=1S/C18H16FNO2S/c19-14-7-5-13(6-8-14)18(16-4-2-12-23-16)20-17(21)10-9-15-3-1-11-22-15/h1-8,11-12,18H,9-10H2,(H,20,21)/t18-/m0/s1 |
| InChIKey | IYZKTCBMQCHISU-SFHVURJKSA-N |
| XLogP | 4.32 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |