C25H23FN2O2S — CID 18269944
2-[benzyl(furan-2-ylmethyl)amino]-N-[(4-fluorophenyl)-thiophen-2-ylmethyl]acetamide (PubChem CID 18269944) has the molecular formula C25H23FN2O2S and a molecular weight of 434.54 g/mol. Its IUPAC name is 2-[benzyl(furan-2-ylmethyl)amino]-N-[(4-fluorophenyl)-thiophen-2-ylmethyl]acetamide.
| Compound Name | 2-[benzyl(furan-2-ylmethyl)amino]-N-[(4-fluorophenyl)-thiophen-2-ylmethyl]acetamide |
|---|---|
| PubChem CID | 18269944 |
| Molecular Formula | C25H23FN2O2S |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 2-[benzyl(furan-2-ylmethyl)amino]-N-[(4-fluorophenyl)-thiophen-2-ylmethyl]acetamide |
| SMILES | O=C(CN(Cc1ccccc1)Cc1ccco1)NC(c1ccc(F)cc1)c1cccs1 |
| InChI | InChI=1S/C25H23FN2O2S/c26-21-12-10-20(11-13-21)25(23-9-5-15-31-23)27-24(29)18-28(17-22-8-4-14-30-22)16-19-6-2-1-3-7-19/h1-15,25H,16-18H2,(H,27,29) |
| InChIKey | LTGFUPXKDYUSSH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |